CAS 1827685-24-4 is the registry number for (E)-5-(tert-Butyl)-3-styrylbenzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-tert-butyl-3-[(E)-2-phenylethenyl]-1,2-benzothiazole 1,1-dioxide (CAS 1827685-24-4) is a chemical compound with the molecular formula C19H19NO2S and a molecular weight of 325.4 g/mol. IUPAC name: 5-tert-butyl-3-[(E)-2-phenylethenyl]-1,2-benzothiazole 1,1-dioxide. InChIKey: JMOPMJRMXYVKBL-PKNBQFBNSA-N.
| Molecular formula | C19H19NO2S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 5-tert-butyl-3-[(E)-2-phenylethenyl]-1,2-benzothiazole 1,1-dioxide |
| InChIKey | JMOPMJRMXYVKBL-PKNBQFBNSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)S(=O)(=O)N=C2/C=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)