Products 332358-90-4

CAS 332358-90-4 is the registry number for 2-(3,3-Dimethyl-3,4-dihydro-isoquinolin-1-yl-methylsulfanyl)-benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylsulfanyl]benzoic acid (CAS 332358-90-4) is a chemical compound with the molecular formula C19H19NO2S and a molecular weight of 325.4 g/mol. IUPAC name: 2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylsulfanyl]benzoic acid. InChIKey: FHOXRVCLHWCBCV-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19NO2S
Molecular weight325.4 g/mol
IUPAC name2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylsulfanyl]benzoic acid
InChIKeyFHOXRVCLHWCBCV-UHFFFAOYSA-N
SMILESCC1(CC2=CC=CC=C2C(=N1)CSC3=CC=CC=C3C(=O)O)C

Computed by PubChem (NCBI)