CAS 18281-92-0 is the registry number for ß-D-Glucofuranuronic acid gama-lactone. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (CAS 18281-92-0) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. IUPAC name: (2R,3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one. InChIKey: OGLCQHRZUSEXNB-APMUVNQYSA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | (2R,3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| InChIKey | OGLCQHRZUSEXNB-APMUVNQYSA-N |
| SMILES | [C@H]1([C@@H]2[C@@H]([C@@H](C(=O)O2)O)O[C@H]1O)O |
Computed by PubChem (NCBI)