Products 1354064-87-1
CAS 1354064-87-1 appears in our catalog under these names: L–Ascorbic acid–13C6, L-Ascorbic Acid-13C6, L-Ascorbic acid-13C6, 99.90%. Offered by: GLPBio, Chemat Brand, MedChemExpress. Available pack sizes: 1mg, on request, 1 mg, 10 mg, 5 mg.
(2R)-2-[(1S)-1,2-dihydroxy(1,2-13C2)ethyl]-3,4-dihydroxy-(2,3,4,5-13C4)2H-furan-5-one (CAS 1354064-87-1) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 182.08 g/mol. IUPAC name: (2R)-2-[(1S)-1,2-dihydroxy(1,2-13C2)ethyl]-3,4-dihydroxy-(2,3,4,5-13C4)2H-furan-5-one. InChIKey: CIWBSHSKHKDKBQ-RQFYRPEFSA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 182.08 g/mol |
| IUPAC name | (2R)-2-[(1S)-1,2-dihydroxy(1,2-13C2)ethyl]-3,4-dihydroxy-(2,3,4,5-13C4)2H-furan-5-one |
| InChIKey | CIWBSHSKHKDKBQ-RQFYRPEFSA-N |
| SMILES | [13CH2]([13C@@H]([13C@@H]1[13C](=[13C]([13C](=O)O1)O)O)O)O |
Computed by PubChem (NCBI)