CAS 182878-29-1 is the registry number for 3,6-Bis(chloromethyl)piperazine-2,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-bis(chloromethyl)piperazine-2,5-dione (CAS 182878-29-1) is a chemical compound with the molecular formula C6H8Cl2N2O2 and a molecular weight of 211.04 g/mol. IUPAC name: 3,6-bis(chloromethyl)piperazine-2,5-dione. InChIKey: UJDFUUWGCSFGOJ-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2N2O2 |
|---|---|
| Molecular weight | 211.04 g/mol |
| IUPAC name | 3,6-bis(chloromethyl)piperazine-2,5-dione |
| InChIKey | UJDFUUWGCSFGOJ-UHFFFAOYSA-N |
| SMILES | C(C1C(=O)NC(C(=O)N1)CCl)Cl |
Computed by PubChem (NCBI)