CAS 89415-87-2 is the registry number for 1,3-Dichloro-5-ethyl-5-methylhydantoin. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione (CAS 89415-87-2) is a chemical compound with the molecular formula C6H8Cl2N2O2 and a molecular weight of 211.04 g/mol. IUPAC name: 1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione. InChIKey: OFTZZDZZNXTWFO-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2N2O2 |
|---|---|
| Molecular weight | 211.04 g/mol |
| IUPAC name | 1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione |
| InChIKey | OFTZZDZZNXTWFO-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)N(C(=O)N1Cl)Cl)C |
Computed by PubChem (NCBI)