Products 1828823-36-4
CAS 1828823-36-4 is the registry number for 1-(2,4-Difluorobenzyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2,4-difluorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1828823-36-4) is a chemical compound with the molecular formula C12H14ClF2NO2 and a molecular weight of 277.69 g/mol. IUPAC name: 1-[(2,4-difluorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: GABJTDKDWNCTOP-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO2 |
|---|---|
| Molecular weight | 277.69 g/mol |
| IUPAC name | 1-[(2,4-difluorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | GABJTDKDWNCTOP-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)CC2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)