Products 2270910-54-6
CAS 2270910-54-6 is the registry number for 4-(3,3-Difluoro-pyrrolidin-1-ylmethyl)-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoic acid;hydrochloride (CAS 2270910-54-6) is a chemical compound with the molecular formula C12H14ClF2NO2 and a molecular weight of 277.69 g/mol. IUPAC name: 4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoic acid;hydrochloride. InChIKey: UBEQDMOEIVGQKF-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO2 |
|---|---|
| Molecular weight | 277.69 g/mol |
| IUPAC name | 4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzoic acid;hydrochloride |
| InChIKey | UBEQDMOEIVGQKF-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)CC2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)