Products 1830344-45-0

CAS 1830344-45-0 is the registry number for 4-(Dibutylamino)butanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(dibutylamino)butanoic acid;hydrochloride (CAS 1830344-45-0) is a chemical compound with the molecular formula C12H26ClNO2 and a molecular weight of 251.79 g/mol. IUPAC name: 4-(dibutylamino)butanoic acid;hydrochloride. InChIKey: SLRDPIGTFZQIPD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H26ClNO2
Molecular weight251.79 g/mol
IUPAC name4-(dibutylamino)butanoic acid;hydrochloride
InChIKeySLRDPIGTFZQIPD-UHFFFAOYSA-N
SMILESCCCCN(CCCC)CCCC(=O)O.Cl

Computed by PubChem (NCBI)