CAS 1989638-08-5 is the registry number for tert-Butyl (3S)-3-(aminomethyl)-5-methylhexanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CAS 1989638-08-5) is a chemical compound with the molecular formula C12H26ClNO2 and a molecular weight of 251.79 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride. InChIKey: OFUQYQDOPTVDGI-PPHPATTJSA-N.
| Molecular formula | C12H26ClNO2 |
|---|---|
| Molecular weight | 251.79 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| InChIKey | OFUQYQDOPTVDGI-PPHPATTJSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)OC(C)(C)C)CN.Cl |
Computed by PubChem (NCBI)