CAS 1831092-94-4 is the registry number for NVS2.1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methyl-2-phenyl-3-propan-2-ylbenzo[b][1,6]naphthyridine-1,10-dione (CAS 1831092-94-4) is a chemical compound with the molecular formula C22H20N2O2 and a molecular weight of 344.4 g/mol. IUPAC name: 5-methyl-2-phenyl-3-propan-2-ylbenzo[b][1,6]naphthyridine-1,10-dione. InChIKey: GHUBGMLACFUDTC-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 5-methyl-2-phenyl-3-propan-2-ylbenzo[b][1,6]naphthyridine-1,10-dione |
| InChIKey | GHUBGMLACFUDTC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1C4=CC=CC=C4 |
Computed by PubChem (NCBI)