CAS 18317-88-9 is the registry number for cis-1,4a,5,8a-Tetrahydro-2,6-naphthalenedione. Offered by: TRC. Available pack sizes: 250mg.
(4aS,8aS)-1,4a,5,8a-tetrahydronaphthalene-2,6-dione (CAS 18317-88-9) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: (4aS,8aS)-1,4a,5,8a-tetrahydronaphthalene-2,6-dione. InChIKey: IFXCIIVCZUQGEV-HTQZYQBOSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (4aS,8aS)-1,4a,5,8a-tetrahydronaphthalene-2,6-dione |
| InChIKey | IFXCIIVCZUQGEV-HTQZYQBOSA-N |
| SMILES | C1[C@H]2C=CC(=O)C[C@H]2C=CC1=O |
Computed by PubChem (NCBI)