Products 183180-53-2
CAS 183180-53-2 appears in our catalog under these names: tert-Butyl 2-(3-Aminophenyl)acetate, tert-Butyl 2-(3-aminophenyl)acetate, 95%, tert-Butyl 2-(3-aminophenyl)acetate, 96%, tert-Butyl 2-(3-aminophenyl)acetate, 96%, 96%. Offered by: TRC, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 500mg, 250mg, 1g, 100mg.
Tert-butyl 2-(3-aminophenyl)acetate (CAS 183180-53-2) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 2-(3-aminophenyl)acetate. InChIKey: SCZSWYDHGXBSOV-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 2-(3-aminophenyl)acetate |
| InChIKey | SCZSWYDHGXBSOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC(=CC=C1)N |
Computed by PubChem (NCBI)