CAS 183201-49-2 appears in our catalog under these names: (R)-1-Cyclopentyl-1-phenylethane-1,2-diol, 95%, (R)-1-Cyclopentyl-1-phenylethane-1,2-diol, 97%, (R)–1–Cyclopentyl–1–phenylethane–1,2–diol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
(1R)-1-cyclopentyl-1-phenylethane-1,2-diol (CAS 183201-49-2) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: (1R)-1-cyclopentyl-1-phenylethane-1,2-diol. InChIKey: PZTPLIMWPOIMPS-ZDUSSCGKSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (1R)-1-cyclopentyl-1-phenylethane-1,2-diol |
| InChIKey | PZTPLIMWPOIMPS-ZDUSSCGKSA-N |
| SMILES | C1CCC(C1)[C@](CO)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)