Products 18323-56-3
CAS 18323-56-3 is the registry number for Z-Ala-leu-nh2, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
Benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate (CAS 18323-56-3) is a chemical compound with the molecular formula C17H25N3O4 and a molecular weight of 335.4 g/mol. IUPAC name: benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate. InChIKey: RVVQEXKXIZCDGV-JSGCOSHPSA-N.
| Molecular formula | C17H25N3O4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | RVVQEXKXIZCDGV-JSGCOSHPSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)