Products 201809-20-3

CAS 201809-20-3 is the registry number for 4-(5-Ethoxycarbonyl-pyridin-2-yl)-piperazine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(5-ethoxycarbonyl-2-pyridinyl)piperazine-1-carboxylate (CAS 201809-20-3) is a chemical compound with the molecular formula C17H25N3O4 and a molecular weight of 335.4 g/mol. IUPAC name: tert-butyl 4-(5-ethoxycarbonyl-2-pyridinyl)piperazine-1-carboxylate. InChIKey: AYCWMHWDFCCHLE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25N3O4
Molecular weight335.4 g/mol
IUPAC nametert-butyl 4-(5-ethoxycarbonyl-2-pyridinyl)piperazine-1-carboxylate
InChIKeyAYCWMHWDFCCHLE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(C=C1)N2CCN(CC2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)