Products 1833471-56-9
CAS 1833471-56-9 is the registry number for 2-Chloro-4-fluoro-N-(piperidin-3-yl)benzamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-fluoro-N-piperidin-3-ylbenzamide;hydrochloride (CAS 1833471-56-9) is a chemical compound with the molecular formula C12H15Cl2FN2O and a molecular weight of 293.16 g/mol. IUPAC name: 2-chloro-4-fluoro-N-piperidin-3-ylbenzamide;hydrochloride. InChIKey: HHKSNCWOAQYTMB-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2FN2O |
|---|---|
| Molecular weight | 293.16 g/mol |
| IUPAC name | 2-chloro-4-fluoro-N-piperidin-3-ylbenzamide;hydrochloride |
| InChIKey | HHKSNCWOAQYTMB-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)NC(=O)C2=C(C=C(C=C2)F)Cl.Cl |
Computed by PubChem (NCBI)