Products 2913242-53-0
CAS 2913242-53-0 appears in our catalog under these names: (4-Aminopiperidin-1-yl)(2-chloro-5-fluorophenyl)methanone hydrochloride, 97%, 97%, (4-Aminopiperidin-1-yl)(2-chloro-5-fluorophenyl)methanone hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-aminopiperidin-1-yl)-(2-chloro-5-fluorophenyl)methanone;hydrochloride (CAS 2913242-53-0) is a chemical compound with the molecular formula C12H15Cl2FN2O and a molecular weight of 293.16 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-(2-chloro-5-fluorophenyl)methanone;hydrochloride. InChIKey: ROYZOTKXTKDJSL-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2FN2O |
|---|---|
| Molecular weight | 293.16 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-(2-chloro-5-fluorophenyl)methanone;hydrochloride |
| InChIKey | ROYZOTKXTKDJSL-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=C(C=CC(=C2)F)Cl.Cl |
Computed by PubChem (NCBI)