CAS 18337-64-9 appears in our catalog under these names: 5-Phenyl-4,6-pyrimidinediol, 95%, 6-Hydroxy-5-phenylpyrimidin-4(1H)-one, 97%, 6–Hydroxy–5–phenylpyrimidin–4(1H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-hydroxy-5-phenyl-1H-pyrimidin-6-one (CAS 18337-64-9) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 4-hydroxy-5-phenyl-1H-pyrimidin-6-one. InChIKey: IRGAQJPJIPBZCT-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-hydroxy-5-phenyl-1H-pyrimidin-6-one |
| InChIKey | IRGAQJPJIPBZCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CNC2=O)O |
Computed by PubChem (NCBI)