Products 183383-30-4

CAS 183383-30-4 is the registry number for tert-Butyl 4-Formylpiperazine-1-Carboxylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 4-formylpiperazine-1-carboxylate (CAS 183383-30-4) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 4-formylpiperazine-1-carboxylate. InChIKey: NKFAHRCLUXUXTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O3
Molecular weight214.26 g/mol
IUPAC nametert-butyl 4-formylpiperazine-1-carboxylate
InChIKeyNKFAHRCLUXUXTJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C=O

Computed by PubChem (NCBI)