CAS 18342-39-7 appears in our catalog under these names: Ramifenazone Hydrochloride, Ramifenazone Hydrochloride Salt. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC. Available pack sizes: on request, 50mg, 100mg, 10mg.
1,5-dimethyl-2-phenyl-4-(propan-2-ylamino)pyrazol-3-one;hydrochloride (CAS 18342-39-7) is a chemical compound with the molecular formula C14H20ClN3O and a molecular weight of 281.78 g/mol. IUPAC name: 1,5-dimethyl-2-phenyl-4-(propan-2-ylamino)pyrazol-3-one;hydrochloride. InChIKey: WJPVTNJDDFIBKU-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3O |
|---|---|
| Molecular weight | 281.78 g/mol |
| IUPAC name | 1,5-dimethyl-2-phenyl-4-(propan-2-ylamino)pyrazol-3-one;hydrochloride |
| InChIKey | WJPVTNJDDFIBKU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(C)C.Cl |
Computed by PubChem (NCBI)