CAS 701220-40-8 appears in our catalog under these names: [3-Chloro-4-(4-isobutyrylpiperazin-1-yl)phenyl]amine, 95%, (3-Chloro-4-(4-isobutyrylpiperazin-1-yl)phenyl)amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
1-[4-(4-amino-2-chlorophenyl)piperazin-1-yl]-2-methylpropan-1-one (CAS 701220-40-8) is a chemical compound with the molecular formula C14H20ClN3O and a molecular weight of 281.78 g/mol. IUPAC name: 1-[4-(4-amino-2-chlorophenyl)piperazin-1-yl]-2-methylpropan-1-one. InChIKey: LZBYAZKZDQWCQM-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3O |
|---|---|
| Molecular weight | 281.78 g/mol |
| IUPAC name | 1-[4-(4-amino-2-chlorophenyl)piperazin-1-yl]-2-methylpropan-1-one |
| InChIKey | LZBYAZKZDQWCQM-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)N1CCN(CC1)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)