CAS 18355-84-5 appears in our catalog under these names: 2–(2,3–difluorophenyl)propan–2–amine hydrochloride, 2-(2,3-difluorophenyl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 50mg.
2-(2,3-difluorophenyl)propan-2-amine (CAS 18355-84-5) is a chemical compound with the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. IUPAC name: 2-(2,3-difluorophenyl)propan-2-amine. InChIKey: TWXARICHYPKPPC-UHFFFAOYSA-N.
| Molecular formula | C9H11F2N |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)propan-2-amine |
| InChIKey | TWXARICHYPKPPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=CC=C1)F)F)N |
Computed by PubChem (NCBI)