CAS 1835652-66-8 is the registry number for YZ51. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-cyclopropyl-2-fluoro-N-(4-hydroxyphenyl)benzamide (CAS 1835652-66-8) is a chemical compound with the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. IUPAC name: 4-cyclopropyl-2-fluoro-N-(4-hydroxyphenyl)benzamide. InChIKey: MWPGUZTXBTYJCD-UHFFFAOYSA-N.
| Molecular formula | C16H14FNO2 |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluoro-N-(4-hydroxyphenyl)benzamide |
| InChIKey | MWPGUZTXBTYJCD-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C(=O)NC3=CC=C(C=C3)O)F |
Computed by PubChem (NCBI)