CAS 793679-40-0 is the registry number for N-(4-Fluoro-2-methylphenyl)-3-oxo-3-phenylpropanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-fluoro-2-methylphenyl)-3-oxo-3-phenylpropanamide (CAS 793679-40-0) is a chemical compound with the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. IUPAC name: N-(4-fluoro-2-methylphenyl)-3-oxo-3-phenylpropanamide. InChIKey: AKPPMUIFVLPPMP-UHFFFAOYSA-N.
| Molecular formula | C16H14FNO2 |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | N-(4-fluoro-2-methylphenyl)-3-oxo-3-phenylpropanamide |
| InChIKey | AKPPMUIFVLPPMP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)NC(=O)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)