CAS 1835759-79-9 appears in our catalog under these names: Acid-peg3-nhs ester, 95%, Acid–C2–PEG3–NHS ester, COOH-PEG3-NHS, Acid-peg3-nhs ester 95%, Propanoic acid, 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]-, 1-(2,5-dioxo-1-pyrrolidinyl) ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 0,25g, 0,1g, 0,5g, 2g, 50mg.
3-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoic acid (CAS 1835759-79-9) is a chemical compound with the molecular formula C14H21NO9 and a molecular weight of 347.32 g/mol. IUPAC name: 3-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ROYPWGXODZJYGP-UHFFFAOYSA-N.
| Molecular formula | C14H21NO9 |
|---|---|
| Molecular weight | 347.32 g/mol |
| IUPAC name | 3-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ROYPWGXODZJYGP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)