CAS 26108-75-8 is the registry number for (2S,3R,4R,5S,6R)–6–(acetoxymethyl)–3–aminotetrahydro–2H–pyran–2,4,5–triyl triacetate. Offered by: GLPBio. Available pack sizes: 1g.
[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-aminooxan-2-yl]methyl acetate (CAS 26108-75-8) is a chemical compound with the molecular formula C14H21NO9 and a molecular weight of 347.32 g/mol. IUPAC name: [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-aminooxan-2-yl]methyl acetate. InChIKey: ZRAWPYYLRZSVEU-DHGKCCLASA-N.
| Molecular formula | C14H21NO9 |
|---|---|
| Molecular weight | 347.32 g/mol |
| IUPAC name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-aminooxan-2-yl]methyl acetate |
| InChIKey | ZRAWPYYLRZSVEU-DHGKCCLASA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)