Products 1835764-98-1
CAS 1835764-98-1 is the registry number for 5-(Chloromethyl)-3-methyl-4-nitro-1,2-oxazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(chloromethyl)-3-methyl-4-nitro-1,2-oxazole (CAS 1835764-98-1) is a chemical compound with the molecular formula C5H5ClN2O3 and a molecular weight of 176.56 g/mol. IUPAC name: 5-(chloromethyl)-3-methyl-4-nitro-1,2-oxazole. InChIKey: GSSWSCRYBMTIGX-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O3 |
|---|---|
| Molecular weight | 176.56 g/mol |
| IUPAC name | 5-(chloromethyl)-3-methyl-4-nitro-1,2-oxazole |
| InChIKey | GSSWSCRYBMTIGX-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)