Products 51876-11-0
CAS 51876-11-0 is the registry number for Hydantoin Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2,5-dioxoimidazolidin-4-yl)acetyl chloride (CAS 51876-11-0) is a chemical compound with the molecular formula C5H5ClN2O3 and a molecular weight of 176.56 g/mol. IUPAC name: 2-(2,5-dioxoimidazolidin-4-yl)acetyl chloride. InChIKey: IKJILNBIBFSCFI-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O3 |
|---|---|
| Molecular weight | 176.56 g/mol |
| IUPAC name | 2-(2,5-dioxoimidazolidin-4-yl)acetyl chloride |
| InChIKey | IKJILNBIBFSCFI-UHFFFAOYSA-N |
| SMILES | C(C1C(=O)NC(=O)N1)C(=O)Cl |
Computed by PubChem (NCBI)