CAS 18368-71-3 appears in our catalog under these names: 4-Methyl-2-nitropyridine, 95%, 4-Methyl-2-nitropyridine, 98%, 4–Methyl–2–nitropyridine, 4-Methyl-2-nitropyridine, 4-Methyl-2-nitropyridine, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g.
4-methyl-2-nitropyridine (CAS 18368-71-3) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 4-methyl-2-nitropyridine. InChIKey: VGENLLAEDBMNSC-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 4-methyl-2-nitropyridine |
| InChIKey | VGENLLAEDBMNSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)