CAS 18368-73-5 appears in our catalog under these names: 2-Nitro-3-methylpyridine, 3–Methyl–2–nitropyridine, 3-Methyl-2-nitropyridine, 3-Methyl-2-nitropyridine 98%, 3-Methyl-2-nitropyridine, 98%, 98%. Offered by: Chemat, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 50g, 100mg, 250mg.
3-methyl-2-nitropyridine (CAS 18368-73-5) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 3-methyl-2-nitropyridine. InChIKey: NNHSGPKSSZLCGT-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 3-methyl-2-nitropyridine |
| InChIKey | NNHSGPKSSZLCGT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)