CAS 18371-09-0 appears in our catalog under these names: 4-[(E)-(4-Chlorophenyl)diazenyl]benzene-1,3-diamine, 95%, 4-((E)-(4-Chlorophenyl)diazenyl)benzene-1,3-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-[(4-chlorophenyl)diazenyl]benzene-1,3-diamine (CAS 18371-09-0) is a chemical compound with the molecular formula C12H11ClN4 and a molecular weight of 246.69 g/mol. IUPAC name: 4-[(4-chlorophenyl)diazenyl]benzene-1,3-diamine. InChIKey: KWDDCOKSYXDDKJ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN4 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)diazenyl]benzene-1,3-diamine |
| InChIKey | KWDDCOKSYXDDKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=C(C=C(C=C2)N)N)Cl |
Computed by PubChem (NCBI)