CAS 887352-40-1 is the registry number for 2-Amino-5-chloro-3,4-dimethyl-3H-imidazo(4,5-f)quinoline, >95% (HPLC). Offered by: TRC. Available pack sizes: 5mg.
5-chloro-3,4-dimethylimidazo[4,5-f]quinolin-2-amine (CAS 887352-40-1) is a chemical compound with the molecular formula C12H11ClN4 and a molecular weight of 246.69 g/mol. IUPAC name: 5-chloro-3,4-dimethylimidazo[4,5-f]quinolin-2-amine. InChIKey: DERKFPUIILAJOW-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN4 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 5-chloro-3,4-dimethylimidazo[4,5-f]quinolin-2-amine |
| InChIKey | DERKFPUIILAJOW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C3C=CC=NC3=C1Cl)N=C(N2C)N |
Computed by PubChem (NCBI)