CAS 183720-28-7 is the registry number for rac-BMS 204352. Offered by: TRC. Available pack sizes: 100mg.
3-(5-chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one (CAS 183720-28-7) is a chemical compound with the molecular formula C16H10ClF4NO2 and a molecular weight of 359.70 g/mol. IUPAC name: 3-(5-chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one. InChIKey: ULYONBAOIMCNEH-UHFFFAOYSA-N.
| Molecular formula | C16H10ClF4NO2 |
|---|---|
| Molecular weight | 359.70 g/mol |
| IUPAC name | 3-(5-chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
| InChIKey | ULYONBAOIMCNEH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C2(C3=C(C=C(C=C3)C(F)(F)F)NC2=O)F |
Computed by PubChem (NCBI)