CAS 187523-35-9 appears in our catalog under these names: BMS 204352, Flindokalner/ 99.25% (existing batch purity), MaxiPost, Flindokalner 99%, (S)-3-(5-Chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)indolin-2-one, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 10mM/1mL.
(3S)-3-(5-chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one (CAS 187523-35-9) is a chemical compound with the molecular formula C16H10ClF4NO2 and a molecular weight of 359.70 g/mol. IUPAC name: (3S)-3-(5-chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one. InChIKey: ULYONBAOIMCNEH-HNNXBMFYSA-N.
| Molecular formula | C16H10ClF4NO2 |
|---|---|
| Molecular weight | 359.70 g/mol |
| IUPAC name | (3S)-3-(5-chloro-2-methoxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
| InChIKey | ULYONBAOIMCNEH-HNNXBMFYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)[C@]2(C3=C(C=C(C=C3)C(F)(F)F)NC2=O)F |
Computed by PubChem (NCBI)