CAS 18374-17-9 is the registry number for (±)-Vincadifformine. Offered by: TRC. Available pack sizes: 75mg.
Methyl (12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate (CAS 18374-17-9) is a chemical compound with the molecular formula C21H26N2O2 and a molecular weight of 338.4 g/mol. IUPAC name: methyl (12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate. InChIKey: GIGFIWJRTMBSRP-OSBQEZSISA-N.
| Molecular formula | C21H26N2O2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | methyl (12R,19R)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
| InChIKey | GIGFIWJRTMBSRP-OSBQEZSISA-N |
| SMILES | CC[C@]12CCCN3[C@H]1C4(CC3)C5=CC=CC=C5NC4=C(C2)C(=O)OC |
Computed by PubChem (NCBI)