CAS 18383-49-8 is the registry number for (1S,4R,6S)-1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo(4.1.0)heptan-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(1S,4R,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one (CAS 18383-49-8) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: (1S,4R,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one. InChIKey: YGMNGQDLUQECTO-UJNFCWOMSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | (1S,4R,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one |
| InChIKey | YGMNGQDLUQECTO-UJNFCWOMSA-N |
| SMILES | CC(=C)[C@@H]1C[C@H]2[C@](O2)(C(=O)C1)C |
Computed by PubChem (NCBI)