Products 1839520-98-7
CAS 1839520-98-7 is the registry number for 3-Amino-n-cyclopropyl-n-(2-methylpropyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-N-cyclopropyl-N-(2-methylpropyl)benzamide (CAS 1839520-98-7) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: 3-amino-N-cyclopropyl-N-(2-methylpropyl)benzamide. InChIKey: FNUFZOOEHAHACL-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 3-amino-N-cyclopropyl-N-(2-methylpropyl)benzamide |
| InChIKey | FNUFZOOEHAHACL-UHFFFAOYSA-N |
| SMILES | CC(C)CN(C1CC1)C(=O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)