Products 1839946-77-8
CAS 1839946-77-8 is the registry number for N-(2-Methylbenzo[d]thiazol-6-yl)azetidine-3-carboxamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-methyl-1,3-benzothiazol-6-yl)azetidine-3-carboxamide;hydrochloride (CAS 1839946-77-8) is a chemical compound with the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. IUPAC name: N-(2-methyl-1,3-benzothiazol-6-yl)azetidine-3-carboxamide;hydrochloride. InChIKey: BMUKIARYUAXWOF-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3OS |
|---|---|
| Molecular weight | 283.78 g/mol |
| IUPAC name | N-(2-methyl-1,3-benzothiazol-6-yl)azetidine-3-carboxamide;hydrochloride |
| InChIKey | BMUKIARYUAXWOF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)NC(=O)C3CNC3.Cl |
Computed by PubChem (NCBI)