Products 746606-50-8
CAS 746606-50-8 is the registry number for N-(tert-Butyl)-3-(6-chloroimidazo[2,1-b]thiazol-5-yl)acrylamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N-tert-butyl-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (CAS 746606-50-8) is a chemical compound with the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. IUPAC name: (E)-N-tert-butyl-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide. InChIKey: NVFXOWMIUOFVIH-SNAWJCMRSA-N.
| Molecular formula | C12H14ClN3OS |
|---|---|
| Molecular weight | 283.78 g/mol |
| IUPAC name | (E)-N-tert-butyl-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| InChIKey | NVFXOWMIUOFVIH-SNAWJCMRSA-N |
| SMILES | CC(C)(C)NC(=O)/C=C/C1=C(N=C2N1C=CS2)Cl |
Computed by PubChem (NCBI)