Products 183996-92-1

CAS 183996-92-1 is the registry number for trans-4-(1-Hydroxy-1-methylethyl)cyclohexanecarboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-hydroxypropan-2-yl)cyclohexane-1-carboxylic acid (CAS 183996-92-1) is a chemical compound with the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. IUPAC name: 4-(2-hydroxypropan-2-yl)cyclohexane-1-carboxylic acid. InChIKey: AVMLEZXKTFPIFG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O3
Molecular weight186.25 g/mol
IUPAC name4-(2-hydroxypropan-2-yl)cyclohexane-1-carboxylic acid
InChIKeyAVMLEZXKTFPIFG-UHFFFAOYSA-N
SMILESCC(C)(C1CCC(CC1)C(=O)O)O

Computed by PubChem (NCBI)