CAS 184026-06-0 appears in our catalog under these names: 2,3-Dicyano-6-nitronaphthalene, 97%, 6-Nitronaphthalene-2,3-dicarbonitrile, 95%, 2,3–Dicyano–6–nitronaphthalene, 2,3-Dicyano-6-nitronaphthalene, >97.0%(GC)(N). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 250mg, 1g, 200mg, 50mg.
6-nitronaphthalene-2,3-dicarbonitrile (CAS 184026-06-0) is a chemical compound with the molecular formula C12H5N3O2 and a molecular weight of 223.19 g/mol. IUPAC name: 6-nitronaphthalene-2,3-dicarbonitrile. InChIKey: JJSGXASWKOLCMQ-UHFFFAOYSA-N.
| Molecular formula | C12H5N3O2 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 6-nitronaphthalene-2,3-dicarbonitrile |
| InChIKey | JJSGXASWKOLCMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)C#N)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)