CAS 68217-29-8 appears in our catalog under these names: 5-Amino-2,3-dicyano-1,4-naphthoquinone, 95%, 5-Amino-2,3-dicyano-1,4-naphthoquinone, 5–Amino–2,3–dicyano–1,4–naphthoquinone, 5-Amino-2,3-dicyano-1,4-naphthoquinone, ≥97%, ≥97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-amino-1,4-dioxonaphthalene-2,3-dicarbonitrile (CAS 68217-29-8) is a chemical compound with the molecular formula C12H5N3O2 and a molecular weight of 223.19 g/mol. IUPAC name: 5-amino-1,4-dioxonaphthalene-2,3-dicarbonitrile. InChIKey: BNBGDHHYNYTXFH-UHFFFAOYSA-N.
| Molecular formula | C12H5N3O2 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 5-amino-1,4-dioxonaphthalene-2,3-dicarbonitrile |
| InChIKey | BNBGDHHYNYTXFH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)C(=C(C2=O)C#N)C#N |
Computed by PubChem (NCBI)