Products 184109-90-8
CAS 184109-90-8 is the registry number for 4-Chloro-2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazoline (CAS 184109-90-8) is a chemical compound with the molecular formula C14H12Cl2N2 and a molecular weight of 279.2 g/mol. IUPAC name: 4-chloro-2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazoline. InChIKey: DHZDWAXFFDIMPE-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2 |
|---|---|
| Molecular weight | 279.2 g/mol |
| IUPAC name | 4-chloro-2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazoline |
| InChIKey | DHZDWAXFFDIMPE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NC(=N2)C3=CC(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)