CAS 2243505-49-7 is the registry number for 4-(Amino(3-chlorophenyl)methyl)benzonitrile hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[amino-(3-chlorophenyl)methyl]benzonitrile;hydrochloride (CAS 2243505-49-7) is a chemical compound with the molecular formula C14H12Cl2N2 and a molecular weight of 279.2 g/mol. IUPAC name: 4-[amino-(3-chlorophenyl)methyl]benzonitrile;hydrochloride. InChIKey: FOEYVKIYXADKOJ-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2 |
|---|---|
| Molecular weight | 279.2 g/mol |
| IUPAC name | 4-[amino-(3-chlorophenyl)methyl]benzonitrile;hydrochloride |
| InChIKey | FOEYVKIYXADKOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C2=CC=C(C=C2)C#N)N.Cl |
Computed by PubChem (NCBI)