CAS 1841119-12-7 is the registry number for (1S)-1-(2-Methoxypyridin-3-yl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S)-1-(2-methoxy-3-pyridinyl)ethanol (CAS 1841119-12-7) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: (1S)-1-(2-methoxy-3-pyridinyl)ethanol. InChIKey: VLIFVHCCBIVTPB-LURJTMIESA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | (1S)-1-(2-methoxy-3-pyridinyl)ethanol |
| InChIKey | VLIFVHCCBIVTPB-LURJTMIESA-N |
| SMILES | C[C@@H](C1=C(N=CC=C1)OC)O |
Computed by PubChem (NCBI)