CAS 184163-26-6 appears in our catalog under these names: 4-Amino-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid, 97%, 4-Amino-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CAS 184163-26-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 4-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. InChIKey: XULBTYRZTZYIRG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 4-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| InChIKey | XULBTYRZTZYIRG-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C=CC(=C2C1)C(=O)O)N |
Computed by PubChem (NCBI)