CAS 1842393-51-4 appears in our catalog under these names: 2',4'-Diamino-5'-(4-carboxyphenyl)-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 2',4'-Diamino-5'-(4-carboxyphenyl)-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2,4-diamino-3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS 1842393-51-4) is a chemical compound with the molecular formula C27H20N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: 4-[2,4-diamino-3,5-bis(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: NKCGTRVQRXTXCX-UHFFFAOYSA-N.
| Molecular formula | C27H20N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 4-[2,4-diamino-3,5-bis(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | NKCGTRVQRXTXCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C(=C2N)C3=CC=C(C=C3)C(=O)O)N)C4=CC=C(C=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)