CAS 87198-87-6 is the registry number for Desmethyl Acridinium C2 NHS Ester. Offered by: TRC. Available pack sizes: 10mg, 1mg, 25mg.
[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl] acridine-9-carboxylate (CAS 87198-87-6) is a chemical compound with the molecular formula C27H20N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: [4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl] acridine-9-carboxylate. InChIKey: GBOJMSAFBYZBOM-UHFFFAOYSA-N.
| Molecular formula | C27H20N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | [4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl] acridine-9-carboxylate |
| InChIKey | GBOJMSAFBYZBOM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCC2=CC=C(C=C2)OC(=O)C3=C4C=CC=CC4=NC5=CC=CC=C53 |
Computed by PubChem (NCBI)