Products 87198-87-6

CAS 87198-87-6 is the registry number for Desmethyl Acridinium C2 NHS Ester. Offered by: TRC. Available pack sizes: 10mg, 1mg, 25mg.

Structural formula: {0} (CAS {1})

[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl] acridine-9-carboxylate (CAS 87198-87-6) is a chemical compound with the molecular formula C27H20N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: [4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl] acridine-9-carboxylate. InChIKey: GBOJMSAFBYZBOM-UHFFFAOYSA-N.

Identity
Molecular formulaC27H20N2O6
Molecular weight468.5 g/mol
IUPAC name[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl] acridine-9-carboxylate
InChIKeyGBOJMSAFBYZBOM-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)CCC2=CC=C(C=C2)OC(=O)C3=C4C=CC=CC4=NC5=CC=CC=C53

Computed by PubChem (NCBI)