CAS 18431-25-9 appears in our catalog under these names: N-(Methylcarbamoyl) Sulfanilamide-N4-acetate, >95% (HPLC), N-(Methylcarbamoyl) sulfanilamide-N4-acetate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.
Methyl N-(4-acetamidophenyl)sulfonylcarbamate (CAS 18431-25-9) is a chemical compound with the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. IUPAC name: methyl N-(4-acetamidophenyl)sulfonylcarbamate. InChIKey: WYSQQGOTBXOTIB-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O5S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | methyl N-(4-acetamidophenyl)sulfonylcarbamate |
| InChIKey | WYSQQGOTBXOTIB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC(=O)OC |
Computed by PubChem (NCBI)